CAS 52378-64-0

(3-bromopyridin-2-yl)methanol

Description:

(3-bromopyridin-2-yl)methanol is an organic compound characterized by its pyridine ring structure, which is substituted with a bromine atom at the 3-position and a hydroxymethyl group at the 2-position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxymethyl group, which can engage in hydrogen bonding. The bromine substituent can influence the compound's reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of both the bromine and hydroxymethyl groups allows for various chemical transformations, including nucleophilic substitutions and coupling reactions. Additionally, (3-bromopyridin-2-yl)methanol may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₆H₆BrNO

InChI: InChI=1/C6H6BrNO/c7-5-2-1-3-8-6(5)4-9/h1-3,9H,4H2

SMILES: c1cc(c(CO)nc1)Br

Synonyms:

• 2-Pyridinemethanol, 3-Bromo-

3-Bromo-2-hydroxymethylpyridine

CAS: 52378-64-0

Formula: C₆H₆BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.0219

Ref: IN-DA00374S

3-Bromo-2-(hydroxymethyl)pyridine

CAS: 52378-64-0

3-Bromo-2-(hydroxymethyl)pyridine

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.02g/mol

Ref: 54-OR60200

(3-Bromopyridin-2-yl)methanol

CAS: 52378-64-0

Formula: C₆H₆BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.024

Ref: 10-F092233