CAS 52382-48-6
:2,2'-bipyridine-5,5'-diamine
Description:
2,2'-Bipyridine-5,5'-diamine, with the CAS number 52382-48-6, is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a nitrogen atom at the 5 and 5' positions. This compound features two amino groups (-NH2) at the 2 and 2' positions of the bipyridine framework, contributing to its potential as a bidentate ligand in coordination chemistry. It is typically a solid at room temperature and is soluble in polar solvents due to the presence of the amino groups, which can engage in hydrogen bonding. The compound exhibits basic properties due to the amino groups, allowing it to participate in various chemical reactions, including coordination with metal ions. Its unique structure enables it to form stable complexes with transition metals, making it of interest in fields such as catalysis and materials science. Additionally, its potential applications may extend to biological systems, where it could interact with biomolecules.
Formula:C10H10N4
InChI:InChI=1/C10H10N4/c11-7-1-3-9(13-5-7)10-4-2-8(12)6-14-10/h1-6H,11-12H2
SMILES:c1cc(c2ccc(cn2)N)ncc1N
Synonyms:- 2,2'-Bipyridin-5,5'-diamin
- 5,5'-Diamino-2,2'-bipyridine
- 52382-48-6
- [2,2'-bipyridine]-5,5'-diamine
- 2,2'-Bipyridine-5,5'-diamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
[2,2'-Bipyridine]-5,5'-diamine
CAS:Formula:C10H10N4Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:186.225,5'-Diamino-2,2'-bipyridine
CAS:Formula:C10H10N4Purity:98%Color and Shape:SolidMolecular weight:186.2132Ref: IN-DA006UG8
1g114.00€5g313.00€10g527.00€25gTo inquire100gTo inquire250gTo inquire100mg34.00€250mg54.00€[2,2'-Bipyridine]-5,5'-diamine
CAS:[2,2'-Bipyridine]-5,5'-diaminePurity:98%Molecular weight:186.22g/mol5,5'-Diamino-2,2'-bipyridine
CAS:<p>5,5'-Diamino-2,2'-bipyridine is an acidic metalloporphyrin that has been shown to react with epoxides to form nucleophilic adducts. This compound can be used as a ligand for lanthanide ions and reacts with aminopyridine to form bromoethane. 5,5'-Diamino-2,2'-bipyridine has been shown to have carcinogenic properties and may induce bromoethane mutagenicity in the liver. This compound is also mutagenic when added to propylene carbonate. 5,5'-Diamino-2,2'-bipyridine is luminescent in air or water when exposed to UV light.</p>Formula:C10H10N4Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:186.21 g/mol[2,2′-Bipyridine]-5,5′-diamine
CAS:Formula:C10H10N4Purity:98%Color and Shape:SolidMolecular weight:186.2185,5'-Diamino-2,2'-bipyridine
CAS:<p>5,5'-Diamino-2,2'-bipyridine is a fine chemical that can be used as a versatile building block in organic synthesis. It is used as a reaction component in research chemicals or speciality chemicals. 5,5'-Diamino-2,2'-bipyridine is also useful as an intermediate for the manufacture of complex compounds. This compound can be used as a reagent in high quality chemical synthesis.</p>Formula:C10H10N4Purity:Min. 95.0 Area-%Molecular weight:186.22 g/molRef: 3D-J-400673
1gTo inquire5gTo inquire10gTo inquire500mgTo inquire2500mgTo inquire-Unit-ggTo inquire





