CAS 52386-11-5

6-amino-2-chloro-pyrimidin-4-ol

Description:

6-Amino-2-chloro-pyrimidin-4-ol is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an amino group (-NH2) at the 6-position and a chloro group (-Cl) at the 2-position, along with a hydroxyl group (-OH) at the 4-position, contributing to its reactivity and potential biological activity. The presence of these functional groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or hydrogen bonding. Its structure allows for potential applications in pharmaceuticals, particularly in the development of antiviral or antibacterial agents, due to the biological significance of pyrimidine derivatives. Additionally, the compound's solubility and stability can be influenced by the substituents on the pyrimidine ring, making it a subject of interest in medicinal chemistry and drug design. As with many chemical substances, safety and handling precautions should be observed, given its potential biological activity.

Formula: C₄H₄ClN₃O

InChI: InChI=1/C4H4ClN3O/c5-4-7-2(6)1-3(9)8-4/h1H,(H3,6,7,8,9)

SMILES: c1c(N)nc(Cl)nc1O

Synonyms:

• 4-Pyrimidinol, 6-Amino-2-Chloro-
• 6-Amino-2-chloropyrimidin-4-ol

4(1H)-Pyrimidinone, 6-amino-2-chloro- (9CI)

CAS: 52386-11-5

Formula: C₄H₄ClN₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 145.5471

Ref: IN-DA003N2A

6-Amino-2-chloropyrimidin-4(3H)-one

CAS: 52386-11-5

6-Amino-2-chloropyrimidin-4(3H)-one

Purity: 97%

Molecular weight: 145.55g/mol

Ref: 54-OR92488

6-Amino-2-chloropyrimidin-4(3H)-one

CAS: 52386-11-5

Purity: 97%

Molecular weight: 145.5500031

Ref: 10-F790696