CAS 52386-52-4

(S)-2-amino-3-phenylpropanehydrazide

Description:

(S)-2-amino-3-phenylpropanehydrazide, also known by its CAS number 52386-52-4, is an organic compound characterized by its hydrazide functional group and chiral center. This compound features a phenyl group attached to a propane backbone, with an amino group and a hydrazide moiety contributing to its reactivity and potential biological activity. The presence of the amino group suggests that it may participate in various chemical reactions, including those typical of amines, such as nucleophilic substitutions. The hydrazide functionality can engage in condensation reactions, making it useful in the synthesis of more complex molecules. Its chirality indicates that it may exhibit different properties or biological activities depending on its stereochemistry, which is crucial in pharmaceutical applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the surrounding environment, including pH and temperature. Overall, (S)-2-amino-3-phenylpropanehydrazide is of interest in medicinal chemistry and may serve as a precursor or intermediate in the synthesis of various bioactive compounds.

Formula: C₉H₁₃N₃O

InChI: InChI=1/C9H13N3O/c10-8(9(13)12-11)6-7-4-2-1-3-5-7/h1-5,8H,6,10-11H2,(H,12,13)

SMILES: c1ccc(cc1)CC(C(=NN)O)N

Synonyms:

• H-Phe-NHNH2
• L-Phenylalanine hydrazide

H-PHE-NHNH2

CAS: 52386-52-4

Formula: C₉H₁₃N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.2190

Ref: IN-DA00DC1M

(S)-2-Amino-3-Phenylpropanehydrazide

CAS: 52386-52-4

(S)-2-Amino-3-Phenylpropanehydrazide

Purity: 98%

Molecular weight: 179.22g/mol

Ref: 54-OR1008673

H-Phe-NHNH2

CAS: 52386-52-4

Ref: 7W-GM1773

H-Phe-NHNH2

CAS: 52386-52-4

M02988 - H-Phe-NHNH2

Formula: C₉H₁₃N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.223

Ref: 10-M02988