CAS 5239-39-4

6,6-dimethylpiperidine-2,4-dione

Description:

6,6-Dimethylpiperidine-2,4-dione, with the CAS number 5239-39-4, is a cyclic compound characterized by its piperidine ring structure, which features two carbonyl groups at the 2 and 4 positions. This compound is a derivative of piperidine, a six-membered nitrogen-containing ring, and is notable for its dimethyl substitutions at the 6-position. The presence of the carbonyl groups contributes to its reactivity, making it a potential intermediate in organic synthesis. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents. The compound can participate in various chemical reactions, including nucleophilic additions and cyclization processes, due to the electrophilic nature of the carbonyl groups. Its applications may extend to pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₁₁NO₂

InChI: InChI=1/C7H11NO2/c1-7(2)4-5(9)3-6(10)8-7/h3-4H2,1-2H3,(H,8,10)

SMILES: CC1(C)CC(=O)CC(=N1)O

6,6-dimethylpiperidine-2,4-dione

CAS: 5239-39-4

Formula: C₇H₁₁NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 141.1677

Ref: IN-DA0038OO

6,6-Dimethylpiperidine-2,4-dione

CAS: 5239-39-4

6,6-Dimethylpiperidine-2,4-dione

Purity: 98%

Molecular weight: 141.17g/mol

Ref: 54-OR315417

6,6-Dimethylpiperidine-2,4-dione

CAS: 5239-39-4

Formula: C₇H₁₁NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 141.17

Ref: 10-F208891