
CAS 5239-43-0
:5-Oxo-1-cyclopentene-1-heptanoic acid
Description:
5-Oxo-1-cyclopentene-1-heptanoic acid, with the CAS number 5239-43-0, is an organic compound characterized by its unique structure that includes a cyclopentene ring and a heptanoic acid moiety. This compound features a ketone functional group (the "5-oxo" part) and a carboxylic acid group, which contribute to its reactivity and potential applications in organic synthesis. The presence of the cyclopentene ring introduces a degree of unsaturation, influencing its chemical behavior and stability. Typically, compounds like this may exhibit properties such as solubility in organic solvents, moderate volatility, and the ability to participate in various chemical reactions, including esterification and condensation. Its specific applications may vary, but it could be relevant in fields such as pharmaceuticals, agrochemicals, or materials science, where unique structural features can lead to novel properties or biological activities. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H18O3
InChI:InChI=1S/C12H18O3/c13-11-8-5-7-10(11)6-3-1-2-4-9-12(14)15/h7H,1-6,8-9H2,(H,14,15)
InChI key:InChIKey=LBOKTHVXIPFAJO-UHFFFAOYSA-N
SMILES:C(CCCCCC(O)=O)C=1C(=O)CCC1
Synonyms:- 1-Cyclopentene-1-heptanoic acid, 5-oxo-
- 5-Oxo-1-cyclopentene-1-heptanoic acid
- 7-(5-Oxo-1-cyclopentenyl)heptanoic acid
- 2-(6′-Carboxyhexyl)-2-cyclopenten-1-one
- 5-Oxo-1-cyclopenten-1-heptanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
