CAS 523977-64-2

4-Bromo-2-cyanobenzaldehyde

Description:

4-Bromo-2-cyanobenzaldehyde is an organic compound characterized by the presence of a bromine atom, a cyano group, and an aldehyde functional group attached to a benzene ring. Its molecular structure features a bromine substituent at the para position and a cyano group at the meta position relative to the aldehyde group. This compound typically appears as a solid at room temperature and is known for its reactivity due to the presence of both the electron-withdrawing cyano group and the aldehyde functionality, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. It is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the formation of more complex molecules. Additionally, 4-Bromo-2-cyanobenzaldehyde may exhibit specific physical properties such as solubility in organic solvents and distinct spectral characteristics in techniques like NMR and IR spectroscopy, aiding in its identification and characterization in laboratory settings.

Formula: C₈H₄BrNO

InChI: InChI=1S/C8H4BrNO/c9-8-2-1-6(5-11)7(3-8)4-10/h1-3,5H

SMILES: c1cc(cc(C#N)c1C=O)Br

Synonyms:

• 5-Bromo-2-Formylbenzonitrile

4-BROMO-2-CYANOBENZALDEHYDE

CAS: 523977-64-2

Formula: C₈H₄BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 210.0275

Ref: IN-DA00DAFK

5-Bromo-2-formylbenzonitrile

CAS: 523977-64-2

5-Bromo-2-formylbenzonitrile

Purity: 95%

Molecular weight: 210.03g/mol

Ref: 54-OR961690

4-Bromo-2-cyanobenzaldehyde

CAS: 523977-64-2

Formula: C₈H₄BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 210.03

Ref: 10-F231158