CAS 524-03-8
:(7S)-6,7-Dihydro-4,7-dimethyl-5H-cyclopenta[c]pyridine
Description:
(7S)-6,7-Dihydro-4,7-dimethyl-5H-cyclopenta[c]pyridine, with CAS number 524-03-8, is a bicyclic organic compound characterized by its unique structure that includes a pyridine ring fused to a cyclopentane moiety. This compound features a nitrogen atom in the pyridine ring, contributing to its basicity and potential reactivity. The presence of two methyl groups at the 4 and 7 positions enhances its hydrophobic character and may influence its biological activity. The stereochemistry indicated by the (7S) designation suggests a specific spatial arrangement of atoms, which can significantly affect the compound's interactions in biological systems. This substance is of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential pharmacological properties. Its physical properties, such as solubility and melting point, can vary based on environmental conditions and the presence of functional groups. Overall, (7S)-6,7-Dihydro-4,7-dimethyl-5H-cyclopenta[c]pyridine represents a fascinating example of nitrogen-containing heterocycles in organic chemistry.
Formula:C10H13N
InChI:InChI=1S/C10H13N/c1-7-3-4-9-8(2)5-11-6-10(7)9/h5-7H,3-4H2,1-2H3/t7-/m0/s1
InChI key:InChIKey=ZHQQRIUYLMXDPP-ZETCQYMHSA-N
SMILES:CC1=C2C([C@@H](C)CC2)=CN=C1
Synonyms:- L-(-)-Actinidine
- 5H-Cyclopenta[c]pyridine, 6,7-dihydro-4,7-dimethyl-, (7S)-
- Actinidine
- 5H-2-Pyrindine, 6,7-dihydro-4,7-dimethyl-, (S)-
- (7S)-6,7-Dihydro-4,7-dimethyl-5H-cyclopenta[c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
