CAS 524-07-2
:5-Hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinecarboxylic acid
Description:
5-Hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinecarboxylic acid, commonly known as pyridoxine or vitamin B6, is a water-soluble vitamin that plays a crucial role in various biochemical processes within the body. This compound is characterized by its pyridine ring structure, which is substituted with hydroxyl and carboxylic acid functional groups, contributing to its solubility and reactivity. It is essential for amino acid metabolism, neurotransmitter synthesis, and the production of hemoglobin. Pyridoxine is also involved in the regulation of homocysteine levels, which is important for cardiovascular health. The compound is typically found in various food sources, including meats, whole grains, and legumes, and is often used in dietary supplements. Its stability can be affected by factors such as light and pH, making proper storage conditions important for maintaining its efficacy. Overall, 5-Hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinecarboxylic acid is vital for numerous physiological functions and overall health.
Formula:C8H9NO4
InChI:InChI=1/C8H9NO4/c1-4-7(11)6(3-10)5(2-9-4)8(12)13/h2,10-11H,3H2,1H3,(H,12,13)
InChI key:InChIKey=VJZTVPVXKYQRJZ-UHFFFAOYSA-N
SMILES:C(O)C=1C(C(O)=O)=CN=C(C)C1O
Synonyms:- 3-Pyridinecarboxylic acid, 5-hydroxy-4-(hydroxymethyl)-6-methyl-
- 5-Hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinecarboxylic acid
- 5-Pyridoxic acid
- Nicotinic acid, 5-hydroxy-4-(hydroxymethyl)-6-methyl-
- Pyridoxine Impurity 34
- Vitamin B6 Impurity 86
- Vitamin B6 Impurity 4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
