CAS 524057-25-8
:N-(3-Chloro-4-fluorophenyl)-N′-(4,6-dimethyl-2-pyrimidinyl)guanidine
Description:
N-(3-Chloro-4-fluorophenyl)-N′-(4,6-dimethyl-2-pyrimidinyl)guanidine, with the CAS number 524057-25-8, is a chemical compound characterized by its guanidine structure, which features a guanidine core substituted with a chloro-fluorophenyl group and a dimethylpyrimidinyl moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and may display biological activity, making it of interest in pharmaceutical research. The presence of halogen substituents, like chlorine and fluorine, often influences the compound's lipophilicity and reactivity, potentially enhancing its interaction with biological targets. Additionally, the dimethylpyrimidine group may contribute to its pharmacological profile, possibly affecting its binding affinity and selectivity. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise characterization.
Formula:C13H13ClFN5
InChI:InChI=1S/C13H13ClFN5/c1-7-5-8(2)18-13(17-7)20-12(16)19-9-3-4-11(15)10(14)6-9/h3-6H,1-2H3,(H3,16,17,18,19,20)
InChI key:InChIKey=RGHCLRGUTICRQP-UHFFFAOYSA-N
SMILES:N(C(NC=1N=C(C)C=C(C)N1)=N)C2=CC(Cl)=C(F)C=C2
Synonyms:- Guanidine, N-(3-chloro-4-fluorophenyl)-N′-(4,6-dimethyl-2-pyrimidinyl)-
- 1-(3-Chloro-4-fluorophenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine
- N-(3-Chloro-4-fluorophenyl)-N′-(4,6-dimethyl-2-pyrimidinyl)guanidine
- 1-(3-Chloro-4-fluorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)guanidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(3-Chloro-4-fluorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)guanidine
CAS:Controlled Product<p>Applications N-(3-Chloro-4-fluorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)guanidine (CAS# 524057-25-8) is a useful research chemical compound.<br></p>Formula:C13H13ClFN5Color and Shape:NeatMolecular weight:293.727
