CAS 52407-43-9
:Benzo[b]furan-3-acetonitrile
Description:
Benzo[b]furan-3-acetonitrile, with the CAS number 52407-43-9, is an organic compound characterized by its fused ring structure, which includes a benzo[b]furan moiety and an acetonitrile functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the acetonitrile group introduces a nitrile functional group, making it polar and capable of participating in various chemical reactions, such as nucleophilic additions. Benzo[b]furan derivatives are often studied for their potential biological activities, including anti-inflammatory and anticancer properties. In terms of solubility, it is generally soluble in organic solvents but may have limited solubility in water. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, benzo[b]furan-3-acetonitrile is of interest in both synthetic organic chemistry and medicinal chemistry research.
Formula:C10H7NO
InChI:InChI=1/C10H7NO/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7H,5H2
SMILES:c1ccc2c(c1)c(CC#N)co2
Synonyms:- 1-Benzofuran-3-ylacetonitrile
- 3-Benzofuranacetonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzo[b]furan-3-acetonitrile, 99%
CAS:Benzo[b]furan-3-acetonitrile is an important raw material and intermediate used in organic synthesis, pharmaceuticals agrochemicals and dyestuff fields. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information m
Formula:C10H7NOPurity:99%Color and Shape:Pale yellow to yellow, Crystals or powder or crystalline powderMolecular weight:157.171-Benzofuran-3-ylacetonitrile
CAS:Formula:C10H7NOPurity:95%Color and Shape:SolidMolecular weight:157.16872-(Benzofuran-3-yl)acetonitrile
CAS:2-(Benzofuran-3-yl)acetonitrilePurity:98%Molecular weight:157.17g/mol



