CAS 52415-10-8
:1-bromo-2,3,5,6-tetramethyl-4-nitrobenzene
Description:
1-Bromo-2,3,5,6-tetramethyl-4-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a nitro group on a benzene ring that is further substituted with multiple methyl groups. The presence of the bromine atom introduces a halogen functionality, which can influence the compound's reactivity and solubility. The nitro group is a strong electron-withdrawing group, which can affect the compound's electronic properties and reactivity in electrophilic aromatic substitution reactions. The four methyl groups contribute to the compound's steric bulk and hydrophobic character, potentially impacting its solubility in various solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of other chemical entities. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall structure, which can be influenced by the arrangement of the substituents on the benzene ring.
Formula:C10H12BrNO2
InChI:InChI=1/C10H12BrNO2/c1-5-7(3)10(12(13)14)8(4)6(2)9(5)11/h1-4H3
SMILES:Cc1c(C)c(c(C)c(C)c1Br)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
