CAS 52427-01-7

2-(bromomethyl)-1-chloro-4-nitrobenzene

Description:

2-(Bromomethyl)-1-chloro-4-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group, a bromomethyl group, and a chlorine atom attached to a benzene ring. The presence of the nitro group (-NO2) indicates that it is a strong electron-withdrawing group, which can influence the compound's reactivity and polarity. The bromomethyl group (-CH2Br) serves as a reactive site for further chemical transformations, while the chlorine atom (-Cl) also contributes to the compound's electrophilic properties. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules, due to its functional groups that can participate in nucleophilic substitution reactions. Its physical properties, such as melting point and solubility, are influenced by the presence of these halogen and nitro substituents, which can also affect its stability and reactivity under various conditions. Safety precautions should be taken when handling this compound, as both bromine and chlorine are hazardous substances.

Formula: C₇H₅BrClNO₂

InChI: InChI=1/C7H5BrClNO2/c8-4-5-3-6(10(11)12)1-2-7(5)9/h1-3H,4H2

SMILES: c1cc(c(cc1N(=O)=O)CBr)Cl

Synonyms:

• 2-Chloro-5-nitrobenzyl bromide
• 52427-01-7
• Wnr Dg C1E

2-(Bromomethyl)-1-chloro-4-nitrobenzene

CAS: 52427-01-7

Formula: C₇H₅BrClNO₂

Molecular weight: 250.4771

Ref: IN-DA00DAOO

2-Chloro-5-nitrobenzyl bromide

CAS: 52427-01-7

2-Chloro-5-nitrobenzyl bromide

Purity: ≥95%

Molecular weight: 250.48g/mol

Ref: 54-OR401010

2-(Bromomethyl)-1-chloro-4-nitrobenzene

CAS: 52427-01-7

Versatile small molecule scaffold

Formula: C₇H₅BrClNO₂

Purity: Min. 95%

Molecular weight: 250.48 g/mol

Ref: 3D-CCA42701