CAS 52427-05-1

2-bromo-5-nitrophenol

Description:

2-Bromo-5-nitrophenol is an organic compound characterized by the presence of both bromine and nitro functional groups attached to a phenolic ring. Its molecular structure consists of a phenol group where a bromine atom is substituted at the second position and a nitro group at the fifth position. This compound typically appears as a yellow to orange crystalline solid and is known for its moderate solubility in organic solvents and limited solubility in water. The presence of the bromine and nitro groups contributes to its reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in the production of dyes and pharmaceuticals. Additionally, 2-bromo-5-nitrophenol exhibits properties such as acidity due to the hydroxyl group, and it can participate in electrophilic aromatic substitution reactions. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards.

Formula: C₆H₄BrNO₃

InChI: InChI=1/C6H4BrNO3/c7-5-2-1-4(8(10)11)3-6(5)9/h1-3,9H

SMILES: c1cc(c(cc1N(=O)=O)O)Br

Synonyms:

• Phenol, 2-bromo-5-nitro-
• 2-Bromo-5-nitrophenol

Phenol, 2-bromo-5-nitro-

CAS: 52427-05-1

Formula: C₆H₄BrNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 218.0049

Ref: IN-DA00DHP6

2-Bromo-5-nitrophenol

CAS: 52427-05-1

2-Bromo-5-nitrophenol

Formula: C₆H₄BrNO₃

Purity: ≥95%

Color and Shape: salmon/light tan crystalline powder

Molecular weight: 218.00g/mol

Ref: 54-OR51974

2-Bromo-5-nitrophenol

CAS: 52427-05-1

Formula: C₆H₄BrNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 218.006

Ref: 10-F218412