
CAS 52427-07-3
:2-(4-Morpholinyl)-5-nitrobenzeneacetic acid
Description:
2-(4-Morpholinyl)-5-nitrobenzeneacetic acid, with the CAS number 52427-07-3, is a chemical compound characterized by its unique structure, which includes a nitro group and a morpholine ring attached to a benzeneacetic acid backbone. This compound typically exhibits properties such as being a solid at room temperature and having moderate solubility in polar solvents due to the presence of both hydrophobic and hydrophilic functional groups. The morpholine moiety contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry for its biological activity. The nitro group may also impart specific reactivity, influencing its behavior in chemical reactions. Additionally, this compound may exhibit acidic properties due to the carboxylic acid functional group, allowing it to participate in various acid-base reactions. Overall, 2-(4-Morpholinyl)-5-nitrobenzeneacetic acid is a compound of interest in research and development, particularly in the fields of pharmaceuticals and organic synthesis.
Formula:C12H14N2O5
InChI:InChI=1S/C12H14N2O5/c15-12(16)8-9-7-10(14(17)18)1-2-11(9)13-3-5-19-6-4-13/h1-2,7H,3-6,8H2,(H,15,16)
InChI key:InChIKey=UNELIIKKWOQXFP-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(C=CC(N(=O)=O)=C1)N2CCOCC2
Synonyms:- Benzeneacetic acid, 2-(4-morpholinyl)-5-nitro-
- 2-(4-Morpholinyl)-5-nitrobenzeneacetic acid
- 2-(2-Morpholino-5-nitrophenyl)acetic acid
- 2-Morpholino-5-nitrophenylacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
