CAS 52435-06-0
:5-oxoprolyl-L-histidyl-L-tryptophylseryl-L-tyrosyl-D-alanyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-N-ethyl-L-prolinamide
Description:
The chemical substance known as "5-oxoprolyl-L-histidyl-L-tryptophylseryl-L-tyrosyl-D-alanyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-N-ethyl-L-prolinamide," with the CAS number 52435-06-0, is a complex peptide that features a sequence of amino acids linked by peptide bonds. This compound exhibits characteristics typical of peptides, including potential biological activity, such as interactions with receptors or enzymes in biological systems. Its structure includes various functional groups, which may contribute to its solubility, stability, and reactivity. The presence of specific amino acids suggests that it may have roles in signaling pathways or as a therapeutic agent. Additionally, the inclusion of a diaminomethylidene group indicates potential for further chemical reactivity or modification. Overall, this substance is of interest in biochemical research and may have applications in pharmacology or medicinal chemistry, although specific biological activities and properties would require empirical investigation to fully characterize its behavior in biological contexts.
Formula:C56H78N16O12
InChI:InChI=1/C56H78N16O12/c1-5-60-54(83)45-13-9-21-72(45)55(84)39(12-8-20-61-56(57)58)66-50(79)40(22-30(2)3)67-47(76)31(4)64-49(78)41(23-32-14-16-35(74)17-15-32)68-53(82)44(28-73)71-51(80)42(24-33-26-62-37-11-7-6-10-36(33)37)69-52(81)43(25-34-27-59-29-63-34)70-48(77)38-18-19-46(75)65-38/h6-7,10-11,14-17,26-27,29-31,38-45,62,73-74H,5,8-9,12-13,18-25,28H2,1-4H3,(H,59,63)(H,60,83)(H,64,78)(H,65,75)(H,66,79)(H,67,76)(H,68,82)(H,69,81)(H,70,77)(H,71,80)(H4,57,58,61)/t31-,38+,39+,40+,41+,42+,43+,44+,45+/m1/s1
Synonyms:- [Des-Gly10, D-Ala6]-Lh-Rh Ethylamide Acetate Hydrate
- 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-alanyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-N-ethyl-L-prolinamide
- L-prolinamide, 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-alanyl-L-leucyl-L-arginyl-N-ethyl-
- 5-Oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-alanyl-L-leucyl-L-arginyl-N-ethyl-L-prolinamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Surfagon
CAS:Surfagon is an effective LHRH agonist.Formula:C56H78N16O12Purity:98%Color and Shape:SolidMolecular weight:1167.34Alarelin acetate
CAS:Alarelin acetate is an analog of the gonadotropin-releasing hormone (GnRH) that has been shown to have anticancer properties. It inhibits the growth of cancer cells by inducing apoptosis, or programmed cell death. Alarelin acetate has also been found in urine and has been used as a diagnostic tool for detecting prostate cancer. This drug acts as an inhibitor of protein kinases, which are enzymes that play a key role in cancer cell growth and proliferation. In addition to its anticancer properties, alarelin acetate has been investigated for its potential use in treating other conditions such as endometriosis and infertility. Studies have also shown that it can enhance the analgesic effects of nalbuphine in Chinese hamsters.Formula:C56H78N16O12Purity:Min. 95%Molecular weight:1,167.3 g/mol

