
CAS 52435-67-3
:L-Serine, anhydride with 5′-adenylic acid (1:1)
Description:
L-Serine, anhydride with 5′-adenylic acid (1:1), identified by CAS number 52435-67-3, is a biochemical compound that combines the amino acid L-serine with adenosine monophosphate (AMP) in an anhydride form. This compound is characterized by its role in biochemical pathways, particularly in the synthesis of proteins and nucleotides. L-serine is a non-essential amino acid that plays a crucial role in the metabolism of proteins and is involved in the synthesis of other amino acids, while AMP is a nucleotide that serves as a building block for RNA and plays a key role in energy transfer within cells. The anhydride formation indicates a dehydration reaction between the carboxyl group of L-serine and the phosphate group of AMP, resulting in a compound that may exhibit unique properties, such as altered solubility and reactivity compared to its individual components. This compound may be of interest in biochemical research, particularly in studies related to metabolism, enzymatic reactions, and cellular signaling pathways.
Formula:C13H19N6O9P
InChI:InChI=1S/C13H19N6O9P/c14-5(1-20)13(23)28-29(24,25)26-2-6-8(21)9(22)12(27-6)19-4-18-7-10(15)16-3-17-11(7)19/h3-6,8-9,12,20-22H,1-2,14H2,(H,24,25)(H2,15,16,17)/t5-,6+,8+,9+,12+/m0/s1
InChI key:InChIKey=UVSYURUCZPPUQD-MACXSXHHSA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)O[C@H](COP(OC([C@H](CO)N)=O)(=O)O)[C@H]1O
Synonyms:- L-Serine, anhydride with 5′-adenylic acid (1:1)
- Serine, anhydride with 5′-adenylic acid, L-
- L-Serine, monoanhydride with 5′-adenylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L-Seryl-amp
CAS:<p>L-Seryl-amp is a peptide.</p>Formula:C13H19N6O9PColor and Shape:SolidMolecular weight:434.30
