CymitQuimica logo

CAS 52436-88-1

:

Nor-β-lapachone

Description:
Nor-β-lapachone is a synthetic derivative of lapachone, a naturally occurring compound found in the bark of certain trees in the Tabebuia genus. This chemical substance is characterized by its quinone structure, which contributes to its biological activity. Nor-β-lapachone exhibits potential pharmacological properties, including antitumor and antimicrobial activities, making it a subject of interest in medicinal chemistry. It is known to interact with various biological pathways, particularly those involved in cell proliferation and apoptosis. The compound is typically studied for its ability to induce oxidative stress in cancer cells, leading to cell death. Additionally, Nor-β-lapachone has been investigated for its role in enhancing the efficacy of certain chemotherapeutic agents. Its solubility and stability in different solvents can vary, which is important for its application in drug formulation. As with many chemical substances, safety and handling precautions are essential due to its potential biological effects. Overall, Nor-β-lapachone represents a promising area of research in the development of new therapeutic agents.
Formula:C14H12O3
InChI:InChI=1S/C14H12O3/c1-14(2)7-10-12(16)11(15)8-5-3-4-6-9(8)13(10)17-14/h3-6H,7H2,1-2H3
InChI key:InChIKey=DMSVAEFGRLMACV-UHFFFAOYSA-N
SMILES:O=C1C2=C(C=3C(C1=O)=CC=CC3)OC(C)(C)C2
Synonyms:
  • Naphtho[1,2-b]furan-4,5-dione, 2,3-dihydro-2,2-dimethyl-
  • 2,3-Dihydro-2,2-dimethylnaphtho[1,2-b]furan-4,5-dione
  • Nor-β-lapachone
  • 2,2-Dimethyl-2,3-dihydronaphtho[1,2-b]furan-4,5-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.