CymitQuimica logo

CAS 52446-51-2

:

Benzeneethanol, 4-phenoxy-

Description:
Benzeneethanol, 4-phenoxy- is an organic compound characterized by its aromatic structure, which includes a benzene ring and an ethyl alcohol moiety. The presence of the phenoxy group indicates that it has a phenol derivative, contributing to its potential reactivity and solubility properties. This compound typically exhibits moderate polarity due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. It is often used in various chemical applications, including as an intermediate in organic synthesis and potentially in the formulation of fragrances or pharmaceuticals. The compound's stability is influenced by the substituents on the benzene ring, which can affect its reactivity and interaction with other chemical species. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe usage and compliance with regulatory standards. Overall, Benzeneethanol, 4-phenoxy- is a versatile compound with applications in both industrial and research settings.
Formula:C14H14O2
InChI:InChI=1S/C14H14O2/c15-11-10-12-6-8-14(9-7-12)16-13-4-2-1-3-5-13/h1-9,15H,10-11H2
InChI key:YCSLOQUADRGUFU-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)OC2=CC=C(C=C2)CCO
Found 4 products.