CAS 52449-78-2

1-Chloro-2-naphthalenecarbonitrile

Description:

1-Chloro-2-naphthalenecarbonitrile, with the CAS number 52449-78-2, is an organic compound characterized by its naphthalene backbone substituted with a chlorine atom and a carbonitrile group. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the presence of the naphthalene structure. The chlorine atom introduces a polar functional group, which can influence its reactivity and solubility in various solvents. The carbonitrile group (-C≡N) is a strong electron-withdrawing group, contributing to the compound's overall reactivity, particularly in nucleophilic substitution reactions. 1-Chloro-2-naphthalenecarbonitrile is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its handling requires standard safety precautions, as it may pose health risks if inhaled or ingested. Overall, this compound exemplifies the diverse chemistry of halogenated aromatic compounds and their utility in various chemical applications.

Formula: C₁₁H₆ClN

InChI: InChI=1S/C11H6ClN/c12-11-9(7-13)6-5-8-3-1-2-4-10(8)11/h1-6H

InChI key: InChIKey=UWPBZQSTQOKGLK-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C=CC1C#N)C=CC=C2

Synonyms:

• 1-Chloro-2-cyanonaphthalene
• 1-Chloro-2-naphthonitrile
• 2-Naphthalenecarbonitrile, 1-chloro-
• 2-Naphthonitrile, 1-chloro-
• 1-Chloro-2-naphthalenecarbonitrile