CAS 52450-39-2
:N1-Acetyl-5-methoxykynuramine
Description:
N1-Acetyl-5-methoxykynuramine, with the CAS number 52450-39-2, is a synthetic compound that belongs to the class of kynuramines, which are derivatives of kynurenine, an important metabolite in the tryptophan degradation pathway. This compound is characterized by the presence of an acetyl group and a methoxy group, which contribute to its unique chemical properties and biological activities. It is known for its potential neuroprotective effects and has been studied for its role in modulating oxidative stress and inflammation in the nervous system. The compound exhibits a relatively low solubility in water but is soluble in organic solvents, which is typical for many small organic molecules. Its structure allows for interactions with various biological targets, making it of interest in pharmacological research, particularly in the context of neurodegenerative diseases. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and therapeutic applications.
Formula:C12H16N2O3
InChI:InChI=1S/C12H16N2O3/c1-8(15)14-6-5-12(16)10-7-9(17-2)3-4-11(10)13/h3-4,7H,5-6,13H2,1-2H3,(H,14,15)
InChI key:InChIKey=RJQIZOKNUKRKTP-UHFFFAOYSA-N
SMILES:C(CCNC(C)=O)(=O)C1=CC(OC)=CC=C1N
Synonyms:- N<sup>1</sup>-Acetyl-5-methoxykynuramine
- N<sup>γ</sup>-Acetyl-5-methoxykynurenamine
- NSC 688265
- acetamide, N-[3-(2-amino-5-methoxyphenyl)-3-oxopropyl]-
- N-[3-(2-Amino-5-methoxyphenyl)-3-oxopropyl]acetamide
- N1-Acetyl-5-methoxykynuramine
- Nγ-Acetyl-5-methoxykynurenamine
- N-acetyl-5-methoxy kynurenamine
- Melatonin Impurity 2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

