CAS 52454-37-2
:N-{4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl}glutamic acid
Description:
N-{4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl}glutamic acid, with the CAS number 52454-37-2, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a complex structure that includes a glutamic acid moiety, which is an important amino acid involved in various metabolic processes. The compound is characterized by the presence of a pteridine derivative, specifically 2,4-diaminopteridin, which contributes to its biological activity. The benzoyl group attached to the glutamic acid enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development, particularly in the context of targeting specific biological pathways. Its solubility, stability, and reactivity can vary based on environmental conditions, which are critical for its application in research and therapeutic contexts. Overall, N-{4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl}glutamic acid represents a unique structure with potential implications in biochemistry and pharmacology.
Formula:C20H21N7O5
InChI:InChI=1/C20H21N7O5/c21-16-15-17(27-20(22)26-16)23-9-12(24-15)6-3-10-1-4-11(5-2-10)18(30)25-13(19(31)32)7-8-14(28)29/h1-2,4-5,9,13H,3,6-8H2,(H,25,30)(H,28,29)(H,31,32)(H4,21,22,23,26,27)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
10-Deazaminopterin
CAS:Controlled ProductFormula:C20H21N7O5Color and Shape:NeatMolecular weight:439.42510-Deazaminopterin
CAS:<p>10-Deazaminopterin is a ligand that binds to the ion channel. It has been shown to be an inhibitor of the Na+/K+ ATPase and may regulate cell membrane potentials. 10-Deazaminopterin has also been shown to bind to tyrosine receptor kinases, which are involved in cellular signal transduction. This ligand can be used as a research tool for pharmacology, protein interactions, and antibody production.</p>Formula:C20H21N7O5Purity:Min. 95%Molecular weight:439.4 g/mol10-Deazaaminopterin
CAS:<p>10-Deazaaminopterin is a poly-gamma-glutamyl metabolite of the experimental anticancer drug, a folic acid antagonist, antineoplastic agent enzyme inhibitor.</p>Formula:C20H21N7O5Color and Shape:SolidMolecular weight:439.42




