CAS 524731-02-0
:5-methylthiophene-3-carbohydrazide
Description:
5-Methylthiophene-3-carbohydrazide is an organic compound characterized by its unique structure, which includes a thiophene ring substituted with a methyl group and a carbohydrazide functional group. This compound typically exhibits properties associated with both thiophene derivatives and hydrazides, such as potential biological activity and reactivity due to the presence of the hydrazide moiety. It may display moderate solubility in polar organic solvents, and its melting point can vary based on purity and specific conditions. The presence of the thiophene ring suggests potential applications in organic electronics or as a building block in the synthesis of more complex molecules. Additionally, compounds like 5-methylthiophene-3-carbohydrazide may be investigated for their pharmacological properties, including antimicrobial or anti-inflammatory activities. As with many organic compounds, safety data should be consulted to understand any hazards associated with handling and usage. Overall, this compound represents a versatile structure with potential applications in various fields of chemistry and materials science.
Formula:C6H8N2OS
InChI:InChI=1/C6H8N2OS/c1-4-2-5(3-10-4)6(9)8-7/h2-3H,7H2,1H3,(H,8,9)
SMILES:Cc1cc(cs1)C(=NN)O
Synonyms:- 3-Thiophenecarboxylic Acid, 5-Methyl-, Hydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Methylthiophene-3-carbohydrazide
CAS:<p>5-Methylthiophene-3-carbohydrazide is a white powder that is soluble in water and ethanol. It is used as a reagent for organic synthesis, especially for the production of heterocycles. The chemical name for 5-methylthiophene-3-carbohydrazide is methyl 3-(aminocarbonyl)-5-methylthiophenecarboxylate. It has a molecular weight of 160.06 grams per mole and a melting point of 35°C. It reacts with acid to form an N-methylthiophthalimide, which can then be reacted with various amines to produce diverse products. This compound is also used as a building block in the synthesis of complex molecules such as pharmaceuticals, agrochemicals, or fragrances.</p>Formula:C6H8N2OSPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:156.21 g/mol
