CAS 52481-66-0
:ethyl 2-hydrazinyl-4-methyl-1,3-thiazole-5-carboxylate
Description:
Ethyl 2-hydrazinyl-4-methyl-1,3-thiazole-5-carboxylate, with the CAS number 52481-66-0, is a chemical compound that features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound is characterized by the presence of a hydrazine functional group, which contributes to its reactivity and potential biological activity. The ethyl ester group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The methyl group at the 4-position of the thiazole ring can influence the compound's electronic properties and steric hindrance, potentially affecting its interaction with biological targets. Additionally, the carboxylate moiety may participate in hydrogen bonding and other interactions, which can be significant in biological systems. Overall, this compound's unique structural features suggest potential utility in pharmaceutical research, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through experimental studies.
Formula:C7H11N3O2S
InChI:InChI=1/C7H11N3O2S/c1-3-12-6(11)5-4(2)9-7(10-8)13-5/h3,8H2,1-2H3,(H,9,10)
SMILES:CCOC(=O)c1c(C)nc(NN)s1
Synonyms:- 5-Thiazolecarboxylic acid, 2-hydrazinyl-4-methyl-, ethyl ester
- Ethyl 2-Hydrazino-4-Methyl-1,3-Thiazole-5-Carboxylate
- ethyl 2-hydrazino-4-methyl-thiazole-5-carboxylate
- ethyl 2-hydrazino-4-methyl-1,3-thiazole-5-carboxylate hydrochloride
- 2-Hydrazino-4-methyl-thiazole-5-carboxylic acid ethyl ester
- 2-hydrazino-4-methyl-5-thiazolecarboxylic acid ethyl ester
- Albb-007424
- Thiazole-5-carboxylic acid, 2-hydrazino-4-methyl-, ethyl ester
- -Hydrazino-4-methyl-thiazole-5-carboxylic acid ethyl ester
- ethyl 2-hydrazinyl-4-methyl-1,3-thiazole-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethyl 2-hydrazino-4-methyl-1,3-thiazole-5-carboxylate hydrochloride
CAS:Formula:C7H11N3O2SMolecular weight:201.2461

