CAS 52486-77-8
:8-methoxy-9-methyl-2-(propan-2-yl)-3,9-dihydrofuro[2,3-b]quinolin-4(2H)-one
Description:
8-Methoxy-9-methyl-2-(propan-2-yl)-3,9-dihydrofuro[2,3-b]quinolin-4(2H)-one, with the CAS number 52486-77-8, is a synthetic organic compound characterized by its complex fused ring structure, which includes a quinoline moiety and a furo[2,3-b] framework. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many quinoline derivatives. Its structure suggests potential biological activity, as quinoline derivatives are often investigated for their pharmacological properties, including antimicrobial and anticancer activities. The presence of methoxy and isopropyl groups may influence its lipophilicity and biological interactions. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and UV-Vis spectroscopy, aiding in its identification and characterization. Overall, 8-methoxy-9-methyl-2-(propan-2-yl)-3,9-dihydrofuro[2,3-b]quinolin-4(2H)-one represents a class of compounds with potential applications in medicinal chemistry and drug development.
Formula:C16H19NO3
InChI:InChI=1/C16H19NO3/c1-9(2)13-8-11-15(18)10-6-5-7-12(19-4)14(10)17(3)16(11)20-13/h5-7,9,13H,8H2,1-4H3
Synonyms:- 2-Isopropyl-8-methoxy-9-methyl-3,9-dihydrofuro[2,3-b]quinolin-4(2H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
NSC 77152
CAS:NSC 77152 is a bioactive chemical.Formula:C16H19NO3Color and Shape:SolidMolecular weight:273.33
