CAS 52490-15-0: 2-Butyl-3-(4-hydroxybenzoyl)benzofuran
Description:2-Butyl-3-(4-hydroxybenzoyl)benzofuran, with the CAS number 52490-15-0, is a chemical compound that belongs to the class of benzofurans, which are characterized by a fused benzene and furan ring structure. This particular compound features a butyl group and a hydroxybenzoyl moiety, contributing to its unique chemical properties. It is typically recognized for its potential applications in organic synthesis and as a building block in the development of pharmaceuticals or agrochemicals. The presence of the hydroxy group may impart certain solubility characteristics and influence its reactivity, while the butyl group can affect its hydrophobicity and overall molecular interactions. Additionally, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or literature reference for precise values. Safety and handling considerations should also be taken into account, as with any chemical substance.
Formula:C19H18O3
InChI:InChI=1S/C19H18O3/c1-2-3-7-17-18(15-6-4-5-8-16(15)22-17)19(21)13-9-11-14(20)12-10-13/h4-6,8-12,20H,2-3,7H2,1H3
InChI key:InChIKey=ZHGKQUXXASLVQQ-UHFFFAOYSA-N
SMILES:O=C(C1=CC=C(O)C=C1)C=2C=3C=CC=CC3OC2CCCC
- Synonyms:
- (2-Butyl-1-Benzofuran-3-Yl)(4-Hydroxyphenyl)Methanone
- (2-Butyl-3-benzofuranyl)(4-hydroxyphenyl)methanone
- (2-Butylbenzofuran-3-yl)(4-hydroxyphenyl)methanone
- 2-Butyl-3-(4-hydr2-Butyl-3-(4-hydroxy benzoyl)benzofuranoxy benzoyl)benzofuran
- 2-Butyl-3-(4-hydroxybenzoyl)-benzofuran
- Ketone, 2-butyl-3-benzofuranyl p-hydroxyphenyl
- L 3372
- Methanone, (2-butyl-3-benzofuranyl)(4-hydroxyphenyl)-
- NSC 85438
