CAS 52493-37-5
:2-Cyano-N-hexylacetamide
Description:
2-Cyano-N-hexylacetamide is an organic compound characterized by its amide functional group, which is linked to a hexyl chain and a cyano group. The presence of the cyano group (-CN) imparts notable polarity and potential reactivity, making it useful in various chemical applications. This compound typically exhibits a moderate to high boiling point due to the presence of strong intermolecular forces, such as hydrogen bonding, associated with the amide group. Its solubility in polar solvents is generally favorable, while solubility in non-polar solvents may be limited. 2-Cyano-N-hexylacetamide may also demonstrate biological activity, which could be of interest in pharmaceutical research or agrochemical applications. The compound's structure suggests potential for further derivatization, allowing for the exploration of its reactivity and utility in synthetic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H16N2O
InChI:InChI=1/C9H16N2O/c1-2-3-4-5-8-11-9(12)6-7-10/h2-6,8H2,1H3,(H,11,12)
InChI key:InChIKey=DCCCNVZBXUDMLF-UHFFFAOYSA-N
SMILES:C(NCCCCCC)(CC#N)=O
Synonyms:- N-Hexyl-2-cyanoacetamide
- N-Hexylcyanoacetamide
- acetamide, 2-cyano-N-hexyl-
- 2-Cyano-N-hexylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

