CAS 52494-24-3

2-({5-[(4-methylphenyl)amino]-1,3,4-thiadiazol-2-yl}sulfanyl)acetohydrazide

Description:

2-({5-[(4-methylphenyl)amino]-1,3,4-thiadiazol-2-yl}sulfanyl)acetohydrazide is a chemical compound characterized by its complex structure, which includes a thiadiazole ring, an amino group, and a hydrazide functional group. The presence of the thiadiazole moiety contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The compound features a sulfanyl group, which can enhance its reactivity and interaction with biological targets. Additionally, the 4-methylphenyl group provides hydrophobic characteristics, potentially influencing the compound's solubility and permeability. This substance may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, making it of interest in medicinal chemistry. Its molecular structure suggests that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. Overall, 2-({5-[(4-methylphenyl)amino]-1,3,4-thiadiazol-2-yl}sulfanyl)acetohydrazide represents a unique scaffold for further research and development in the field of pharmaceuticals.

Formula: C₁₁H₁₃N₅OS₂

InChI: InChI=1/C11H13N5OS2/c1-7-2-4-8(5-3-7)13-10-15-16-11(19-10)18-6-9(17)14-12/h2-5H,6,12H2,1H3,(H,13,15)(H,14,17)

SMILES: Cc1ccc(cc1)Nc1nnc(SCC(=NN)O)s1

Synonyms:

• (5-p-Tolylamino-[1,3,4]thiadiazol-2-ylsulfanyl)-acetic acid hydrazide

2-({5-[(4-methylphenyl)amino]-1,3,4-thiadiazol-2-yl}sulfanyl)acetohydrazide

CAS: 52494-24-3

2-({5-[(4-methylphenyl)amino]-1,3,4-thiadiazol-2-yl}sulfanyl)acetohydrazide

Purity: 95%

Molecular weight: 295.38g/mol

Ref: 54-OR84630

2-({5-[(4-methylphenyl)amino]-1,3,4-thiadiazol-2-yl}sulfanyl)acetohydrazide

CAS: 52494-24-3

Purity: 97%

Molecular weight: 295.3800049

Ref: 10-F642576