CAS 52505-42-7

1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone

Description:

1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone, with the CAS number 52505-42-7, is a chemical compound that features a thieno[2,3-b]pyridine core structure, which is characterized by a fused ring system containing both sulfur and nitrogen atoms. This compound possesses an amino group and a ketone functional group, contributing to its potential reactivity and biological activity. The presence of methyl groups at the 4 and 6 positions of the thieno[2,3-b]pyridine ring enhances its lipophilicity, which may influence its pharmacokinetic properties. The compound's structural features suggest it may exhibit interesting interactions with biological targets, making it a candidate for research in medicinal chemistry. Its unique combination of heteroatoms and functional groups may also impart specific properties such as solubility and stability, which are crucial for its application in various chemical and pharmaceutical contexts. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₁H₁₂N₂OS

InChI: InChI=1/C11H12N2OS/c1-5-4-6(2)13-11-8(5)9(12)10(15-11)7(3)14/h4H,12H2,1-3H3

SMILES: Cc1cc(C)nc2c1c(c(C(=O)C)s2)N

Synonyms:

• 1-(3-Amino-4,6-Dimethylthieno[2,3-B]Pyridin-2-Yl)Ethan-1-One
• Ethanone, 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-

1-(3-Amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone

CAS: 52505-42-7

Formula: C₁₁H₁₂N₂OS

Molecular weight: 220.2908

Ref: IN-DA00DD8K

1-(3-Amino-4,6-dimethyl-thieno[2,3-b]pyridin-2-yl)-ethanone

CAS: 52505-42-7

1-(3-Amino-4,6-dimethyl-thieno[2,3-b]pyridin-2-yl)-ethanone (AMT) is a thiosemicarbazone that inhibits the synthesis of DNA. It blocks the nucleotide incorporation into DNA by binding to the enzyme DNA polymerase and inhibiting its activity. AMT has been shown to have antimicrobial properties against a wide range of bacteria, including Staphylococcus aureus, Clostridium perfringens, Mycobacterium tuberculosis, and Mycobacterium avium complex. AMT also has inhibitory effects on mammalian cytochrome P450 enzymes.

Formula: C₁₁H₁₂N₂OS

Purity: Min. 95%

Molecular weight: 220.3 g/mol

Ref: 3D-CCA50542