CAS 52505-56-3
:ethyl 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate
Description:
Ethyl 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes a thieno[2,3-b]pyridine core. This compound features an ethyl ester functional group, an amino group, and two methyl substituents on the pyridine ring, contributing to its unique chemical properties. The presence of the thieno ring system imparts distinct reactivity and potential biological activity, making it of interest in medicinal chemistry. The amino group can participate in hydrogen bonding and may influence the compound's solubility and interaction with biological targets. Ethyl 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate may exhibit various pharmacological activities, although specific biological data would depend on empirical studies. Its CAS number, 52505-56-3, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and organic synthesis. Overall, this compound represents a valuable scaffold for further exploration in drug development and chemical research.
Formula:C12H14N2O2S
InChI:InChI=1/C12H14N2O2S/c1-4-16-12(15)10-9(13)8-6(2)5-7(3)14-11(8)17-10/h5H,4,13H2,1-3H3
SMILES:CCOC(=O)c1c(c2c(C)cc(C)nc2s1)N
Synonyms:- 3-Amino-4,6-dimethyl-thieno[2,3-b]pyridine-2-carboxylic acid ethyl ester
- Thieno[2,3-b]pyridine-2-carboxylic acid, 3-amino-4,6-dimethyl-, ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate
CAS:Formula:C12H14N2O2SPurity:97%Molecular weight:250.3168Ethyl 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate
CAS:<p>Ethyl 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate</p>Purity:95%Molecular weight:250.32g/molEthyl 3-Amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate
CAS:Formula:C12H14N2O2SPurity:97%Color and Shape:SolidMolecular weight:250.32Ethyl 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate
CAS:<p>Ethyl 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate is a heterocyclic compound that is used as a reagent in organic synthesis. It is a polyfunctionalized heterocycle that contains an ethyl ester and an acid ethyl ester moiety. The compound can be prepared by the reaction of thiophene with nitromethane and ethyl iodide followed by hydrolysis.</p>Formula:C12H14N2O2SPurity:Min. 95%Molecular weight:250.32 g/mol



