CAS 52530-60-6
:Angiotensin I/II (4-8)
Description:
Angiotensin I and II are peptides that play crucial roles in the regulation of blood pressure and fluid balance in the body. Angiotensin I is a precursor that is converted into Angiotensin II, a potent vasoconstrictor, by the action of the enzyme angiotensin-converting enzyme (ACE). The specific fragment "Angiotensin I/II (4-8)" refers to a portion of these peptides, typically focusing on the amino acid sequence that corresponds to their biological activity. The CAS number 52530-60-6 identifies a specific chemical substance related to these peptides, which may be used in research or therapeutic applications. Characteristics of Angiotensin peptides include their relatively small size, typically consisting of a few amino acids, and their ability to bind to specific receptors in the body, influencing cardiovascular function and electrolyte balance. These peptides are also involved in various physiological processes, including the regulation of blood pressure, inflammation, and kidney function. Understanding their structure and function is essential for developing treatments for conditions like hypertension and heart failure.
Formula:C35H45N7O7
InChI:InChI=1/C35H45N7O7/c1-3-21(2)30(41-31(44)26(36)16-23-11-13-25(43)14-12-23)33(46)39-27(18-24-19-37-20-38-24)34(47)42-15-7-10-29(42)32(45)40-28(35(48)49)17-22-8-5-4-6-9-22/h4-6,8-9,11-14,19-21,26-30,43H,3,7,10,15-18,36H2,1-2H3,(H,37,38)(H,39,46)(H,40,45)(H,41,44)(H,48,49)/t21-,26-,27-,28-,29-,30-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=N[C@@H](Cc1ccccc1)C(=O)O)O)O)N=C([C@H](Cc1ccc(cc1)O)N)O
Synonyms:- H-Tyr-Ile-His-Pro-Phe-OH
- L-tyrosyl-L-isoleucyl-L-histidyl-L-prolyl-L-phenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Angiotensin pentapeptide
CAS:Angiotensin pentapeptide is a peptide.Formula:C35H45N7O7Purity:98%Color and Shape:SolidMolecular weight:675.77Angiotensin I/II (4-8)
CAS:Angiotensin I/II (4-8) H-Tyr-Ile-His-Pro-Phe-OH is a peptide that contains the sequence of angiotensin I and II. It has been shown to have proton transport properties, which may be related to its sequence. The amino acid sequence of this peptide is similar to other pentapeptides such as insulin and vasopressin. This peptide has been linked to a vector that can cross the blood brain barrier, allowing it to act on the central nervous system.Formula:C35H45N7O7Purity:Min. 95%Molecular weight:675.77 g/mol

