CAS 52531-12-1
:5-Ethylindole-3-acetic acid
Description:
5-Ethylindole-3-acetic acid is a chemical compound that belongs to the class of indole derivatives, which are characterized by a bicyclic structure containing a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This compound features an ethyl group at the 5-position of the indole ring and an acetic acid functional group at the 3-position, contributing to its unique properties. It is known for its potential applications in plant growth regulation, as it may influence various physiological processes in plants. The presence of the indole structure suggests that it may interact with auxin pathways, which are crucial for plant development. Additionally, 5-Ethylindole-3-acetic acid may exhibit biological activities that could be of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary depending on environmental conditions, such as pH and temperature. As with many chemical substances, safety precautions should be taken when handling it, and its effects on health and the environment should be thoroughly evaluated.
Formula:C12H13NO2
InChI:InChI=1/C12H13NO2/c1-2-8-3-4-11-10(5-8)9(7-13-11)6-12(14)15/h3-5,7,13H,2,6H2,1H3,(H,14,15)
SMILES:CCc1ccc2c(c1)c(CC(=O)O)c[nH]2
Synonyms:- (5-ethyl-1H-indol-3-yl)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Ethyl-1H-indole-3-acetic acid
CAS:Formula:C12H13NO2Purity:98%Color and Shape:SolidMolecular weight:203.23712-(5-Ethyl-1H-indol-3-yl)acetic acid
CAS:2-(5-Ethyl-1H-indol-3-yl)acetic acidPurity:95%Molecular weight:202.23g/mol5-Ethylindole-3-acetic acid
CAS:5-Ethylindole-3-acetic acid is a chemical that can be used as a reagent in the lab, or as a reaction component in research.Formula:C12H13NO2Molecular weight:203.24 g/mol5-Ethylindole-3-acetic acid
CAS:5-Ethylindole-3-acetic acid is a high quality chemical that is an intermediate in the synthesis of a variety of complex compounds. It is also a reagent for many reactions and can be used as a building block for more complex compounds. 5-Ethylindole-3-acetic acid has been shown to have antihistamine, analgesic, and antipyretic properties and is useful in treating allergic reactions.
Formula:C12H13NO2Purity:Min. 95%Molecular weight:203.24 g/mol5-Ethylindole-3-acetic acid
CAS:Formula:C12H13NO2Purity:98%Color and Shape:SolidMolecular weight:203.241



