CAS 52532-01-1

5,5-di(propan-2-yl)imidazolidine-2,4-dione

Description:

5,5-Di(propan-2-yl)imidazolidine-2,4-dione, also known as a derivative of imidazolidine, is a cyclic urea compound characterized by its two isopropyl groups attached to the nitrogen atoms of the imidazolidine ring. This structure contributes to its stability and solubility in organic solvents. The compound typically exhibits a white to off-white crystalline appearance and is known for its potential applications in pharmaceuticals and agrochemicals due to its ability to act as a building block in organic synthesis. It may also possess biological activity, although specific pharmacological properties would depend on further studies. The presence of the imidazolidine ring suggests potential reactivity in various chemical reactions, including nucleophilic substitutions and cycloadditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 5,5-di(propan-2-yl)imidazolidine-2,4-dione is a versatile compound with interesting chemical properties and potential applications in various fields.

Formula: C₉H₁₆N₂O₂

InChI: InChI=1/C9H16N2O2/c1-5(2)9(6(3)4)7(12)10-8(13)11-9/h5-6H,1-4H3,(H2,10,11,12,13)

SMILES: CC(C)C1(C(C)C)C(=NC(=N1)O)O

5,5-Bis(propan-2-yl)imidazolidine-2,4-dione

CAS: 52532-01-1

5,5-Bis(propan-2-yl)imidazolidine-2,4-dione is a potent and selective antinociceptive agent. It has been shown to be effective in the treatment of chronic pain. 5,5-Bis(propan-2-yl)imidazolidine-2,4-dione has high potency and selectivity for the peripheral nervous system. It inhibits voltage dependent sodium channels which lead to decreased neuronal excitability. This drug also has anticonvulsant properties which may be due to its ability to inhibit glutamate release.

Formula: C₉H₁₆N₂O₂

Purity: Min. 95%

Molecular weight: 184.24 g/mol

Ref: 3D-CCA53201