CymitQuimica logo

CAS 52537-00-5

:

6-chloro-2,3-dihydro-1H-indole

Description:
6-Chloro-2,3-dihydro-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 6-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-rich nature of the indole ring. Additionally, the dihydro form indicates the presence of two hydrogen atoms that can influence its stability and reactivity. 6-Chloro-2,3-dihydro-1H-indole has garnered interest in medicinal chemistry, particularly for its potential pharmacological properties, including antimicrobial and anticancer activities. As with many indole derivatives, it may also serve as a building block for the synthesis of more complex organic molecules. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C8H8ClN
InChI:InChI=1/C8H8ClN/c9-7-2-1-6-3-4-10-8(6)5-7/h1-2,5,10H,3-4H2
InChI key:HSLNYVREDLDESE-UHFFFAOYSA-N
SMILES:c1cc(cc2c1CCN2)Cl
Synonyms:
  • 6-Chloroindoline
Found 4 products.