CAS 5254-92-2

2-[(1-naphthylmethyl)thio]acetic acid

Description:

2-[(1-Naphthylmethyl)thio]acetic acid, with the CAS number 5254-92-2, is an organic compound characterized by its unique structure that includes a naphthylmethyl group attached to a thioether and an acetic acid moiety. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the naphthyl group contributes to its hydrophobic characteristics, while the acetic acid functional group imparts acidic properties, allowing for interactions in biological systems. Its thioether linkage may influence its reactivity and stability, making it a subject of interest in various chemical reactions. Additionally, the compound's solubility and behavior in different solvents can vary, impacting its utility in synthesis and formulation. Overall, 2-[(1-naphthylmethyl)thio]acetic acid is a compound of interest due to its structural features and potential biological activities.

Formula: C₁₃H₁₂O₂S

InChI: InChI=1/C13H12O2S/c14-13(15)9-16-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8-9H2,(H,14,15)

SMILES: c1ccc2c(c1)cccc2CSCC(=O)O

Synonyms:

• [(Naphthalen-1-Ylmethyl)Sulfanyl]Acetic Acid

2-(Naphth-1-ylmethylthio)acetic acid

CAS: 5254-92-2

2-(Naphth-1-ylmethylthio)acetic acid

Purity: 95%

Molecular weight: 232.30g/mol

Ref: 54-OR0670