CAS 52546-65-3

[1,2,4]Triazolo[1,5-a]pyrazin-8-amine, 2-methyl-

Description:

[1,2,4]Triazolo[1,5-a]pyrazin-8-amine, 2-methyl- is a heterocyclic compound characterized by its fused triazole and pyrazine rings, which contribute to its unique chemical properties. This compound features an amino group at the 8-position of the pyrazine ring and a methyl group at the 2-position of the triazole ring, influencing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound's structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its CAS number, 52546-65-3, is a unique identifier that facilitates the search for information regarding its synthesis, properties, and applications. Overall, this compound exemplifies the diverse chemistry of nitrogen-containing heterocycles, which are often pivotal in pharmaceutical research and development.

Formula: C₆H₇N₅

InChI: InChI=1S/C6H7N5/c1-4-9-6-5(7)8-2-3-11(6)10-4/h2-3H,1H3,(H2,7,8)

InChI key: InChIKey=KGUGTTGRNDVJAC-UHFFFAOYSA-N

SMILES: NC=1C=2N(N=C(C)N2)C=CN1

Synonyms:

• 2-Methyl-[1,2,4]triazolo[1,5-a]pyrazin-8-amine
• [1,2,4]Triazolo[1,5-a]pyrazin-8-amine, 2-methyl-