CAS 52547-07-6
:P-xylylenebis(tetrahydrothiophenium chloride)
Description:
P-xylylenebis(tetrahydrothiophenium chloride), with the CAS number 52547-07-6, is a chemical compound characterized by its unique structure, which includes a p-xylylene backbone and tetrahydrothiophenium groups. This compound typically appears as a solid or crystalline material and is known for its ionic nature due to the presence of chloride ions. It is often utilized in various chemical applications, including as a precursor in organic synthesis and in the development of polymeric materials. The tetrahydrothiophenium moieties contribute to its reactivity, making it suitable for use in processes such as cationic polymerization. Additionally, the compound may exhibit specific solubility characteristics depending on the solvent used, and its stability can be influenced by environmental factors such as temperature and humidity. Safety data should be consulted for handling and storage, as with many chemical substances, to ensure proper precautions are taken. Overall, P-xylylenebis(tetrahydrothiophenium chloride) is a versatile compound with applications in both research and industrial settings.
Formula:C16H24Cl2S2
InChI:InChI=1/C16H24S2.2ClH/c1-2-10-17(9-1)13-15-5-7-16(8-6-15)14-18-11-3-4-12-18;;/h5-8H,1-4,9-14H2;2*1H/q+2;;/p-2
Synonyms:- 1,1'-(Benzene-1,4-Diyldimethanediyl)Ditetrahydrothiophenium Dichloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
