CAS 52548-14-8
:2-Iodo-5-methylbenzoic acid
Description:
2-Iodo-5-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of an iodine atom and a methyl group on a benzoic acid framework. The iodine substituent is located at the second position, while the methyl group is at the fifth position of the benzene ring, which influences its chemical reactivity and physical properties. This compound typically appears as a white to off-white solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. Its molecular structure contributes to its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the iodine atom can enhance the compound's reactivity in nucleophilic substitution reactions, while the carboxylic acid functional group allows for acid-base reactions and the formation of esters. Additionally, 2-Iodo-5-methylbenzoic acid can serve as a useful intermediate in various chemical transformations, making it a valuable compound in synthetic organic chemistry.
Formula:C8H7IO2
InChI:InChI=1S/C8H7IO2/c1-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=INGWGCDYAJKXKP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(I)C=CC(C)=C1
Synonyms:- 5-Methyl-2-iodobenzoic acid
- Benzoic acid, 2-iodo-5-methyl-
- 2-Iodo-5-methylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
2-Iodo-5-methylbenzoic Acid
CAS:Formula:C8H7IO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:262.052-Iodo-5-methylbenzoic acid
CAS:Formula:C8H7IO2Purity:98%Color and Shape:SolidMolecular weight:262.04442-Iodo-5-methylbenzoic acid
CAS:<p>2-Iodo-5-methylbenzoic acid</p>Purity:≥95%Color and Shape:PowderMolecular weight:262.04g/mol2-Iodo-5-methylbenzoic acid, min. 98%
CAS:Formula:C8H7IO2Purity:min. 98%Color and Shape:White to off-white solidMolecular weight:262.052-Iodo-5-methylbenzoic acid
CAS:<p>2-Iodo-5-methylbenzoic acid is a fine chemical, useful building block and reagent that is used in the synthesis of complex compounds. It is versatile because it can be used as a reactant, intermediate or scaffold in many chemical reactions. It has been shown to be an effective catalyst for the Suzuki reaction and Buchwald-Hartwig amination reaction. 2-Iodo-5-methylbenzoic acid has also been found to be a useful intermediate for the synthesis of many pharmaceuticals, such as tamoxifen, griseofulvin, mesalazine, and risperidone.</p>Formula:C8H7IO2Purity:Min. 95%Color and Shape:PowderMolecular weight:262.04 g/mol2-Iodo-5-methylbenzoic acid
CAS:Formula:C8H7IO2Purity:98%Color and Shape:SolidMolecular weight:262.046









