CAS 52548-63-7

5-Fluoro-2-iodobenzoic acid

Description:

5-Fluoro-2-iodobenzoic acid is an aromatic carboxylic acid characterized by the presence of both fluorine and iodine substituents on the benzene ring. Its molecular structure features a benzoic acid core, with a fluorine atom located at the 5-position and an iodine atom at the 2-position of the aromatic ring. This compound is typically a white to off-white solid and is soluble in organic solvents, while its solubility in water may be limited. The presence of halogens can influence its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit unique properties such as altered acidity and reactivity compared to its non-halogenated counterparts. Its CAS number, 52548-63-7, allows for easy identification in chemical databases. Safety precautions should be taken when handling this substance, as it may pose health risks, and proper storage conditions should be observed to maintain its stability.

Formula: C₇H₄FIO₂

InChI: InChI=1/C7H4FIO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11)

SMILES: c1cc(c(cc1F)C(=O)O)I

Synonyms:

• Benzoic Acid, 5-Fluoro-2-Iodo-

5-Fluoro-2-iodobenzoic acid

CAS: 52548-63-7

Formula: C₇H₄FIO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 266.0083

Ref: IN-DA003MQR

5-Fluoro-2-iodobenzoic acid

CAS: 52548-63-7

5-Fluoro-2-iodobenzoic acid

Formula: C₇H₄FIO₂

Purity: 98%

Color and Shape: faint yellow crystalline powder

Molecular weight: 266.01g/mol

Ref: 54-PC2699

5-Fluoro-2-iodobenzoic Acid

CAS: 52548-63-7

Formula: C₇H₄FIO₂

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 266.01

Ref: 3B-F1113

5-Fluoro-2-iodobenzoic acid

CAS: 52548-63-7

Formula: C₇H₄FIO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 266.01

Ref: 10-F033381