CAS 52549-07-2

5H-chromeno[2,3-b]pyridin-7-ylacetic acid

Description:

5H-chromeno[2,3-b]pyridin-7-ylacetic acid, identified by its CAS number 52549-07-2, is a chemical compound that features a fused chromene and pyridine structure. This compound typically exhibits characteristics common to both chromeno and pyridine derivatives, such as potential biological activity and the ability to participate in various chemical reactions due to the presence of functional groups. The carboxylic acid moiety in its structure suggests it can act as an acid, potentially forming salts or esters. Additionally, the fused ring system may contribute to its stability and influence its solubility in different solvents. Compounds of this nature are often studied for their pharmacological properties, including anti-inflammatory and antimicrobial activities. The presence of multiple aromatic rings can also enhance interactions with biological targets, making it a subject of interest in medicinal chemistry. Overall, 5H-chromeno[2,3-b]pyridin-7-ylacetic acid represents a unique scaffold for further research and development in various chemical and pharmaceutical applications.

Formula: C₁₄H₁₁NO₃

InChI: InChI=1/C14H11NO3/c16-13(17)7-9-3-4-12-11(6-9)8-10-2-1-5-15-14(10)18-12/h1-6H,7-8H2,(H,16,17)

SMILES: c1cc2Cc3cc(ccc3Oc2nc1)CC(=O)O

Pranoprofen Impurity 15

CAS: 52549-07-2

Formula: C₁₄H₁₁NO₃

Molecular weight: 241.25

Ref: 4Z-P-110017