CAS 52551-07-2

N-(4-Nitrophenyl)-L-tyrosinamide

Description:

N-(4-Nitrophenyl)-L-tyrosinamide, with the CAS number 52551-07-2, is an organic compound characterized by its structural features, which include a tyrosine derivative with a nitrophenyl group. This compound typically exhibits a yellow crystalline appearance due to the presence of the nitro group, which can influence its electronic properties and reactivity. It is soluble in polar solvents, reflecting the presence of the amide functional group, which enhances its solubility characteristics. The nitrophenyl moiety can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry and medicinal chemistry. Its biological activity may be linked to the interactions of the tyrosine backbone, which is known for its role in protein synthesis and enzyme function. Additionally, the compound may exhibit specific optical properties, making it useful in studies involving fluorescence or UV-Vis spectroscopy. Overall, N-(4-Nitrophenyl)-L-tyrosinamide serves as a valuable compound for research applications, particularly in the fields of biochemistry and pharmacology.

InChI: InChI=1S/C15H15N3O4/c16-14(9-10-1-7-13(19)8-2-10)15(20)17-11-3-5-12(6-4-11)18(21)22/h1-8,14,19H,9,16H2,(H,17,20)/t14-/m0/s1

SMILES: c1cc(ccc1C[C@@H](C(=O)Nc1ccc(cc1)N(=O)=O)N)O

Synonyms:

• H-Tyr-pNA

H-Tyr-pNA

CAS: 52551-07-2

Formula: C₁₅H₁₅N₃O₄

Purity: 95%

Molecular weight: 301.2973

Ref: IN-DA00DJKD

H-Tyr-pNA

CAS: 52551-07-2

M06074 - H-Tyr-pNA

Formula: C₁₅H₁₅N₃O₄

Purity: 95%

Molecular weight: 301.302

Ref: 10-M06074

L-Tyrosine 4-nitroanilide

CAS: 52551-07-2

Please enquire for more information about L-Tyrosine 4-nitroanilide including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₅H₁₅N₃O₄

Purity: Min. 95%

Molecular weight: 301.3 g/mol

Ref: 3D-FT48219