CAS 52554-28-6

Methyl 2,3,5-tri-O-acetyl-D-ribofuranoside

Description:

Methyl 2,3,5-tri-O-acetyl-D-ribofuranoside is a chemical compound that belongs to the class of acetylated sugars, specifically a derivative of ribofuranose. It is characterized by the presence of three acetyl groups attached to the hydroxyl groups at the 2, 3, and 5 positions of the ribofuranose ring, along with a methyl group at the anomeric carbon. This structure enhances its lipophilicity and stability compared to its unmodified counterpart. The compound is typically a white to off-white crystalline solid and is soluble in organic solvents such as chloroform and methanol, but less soluble in water due to its acetylation. Methyl 2,3,5-tri-O-acetyl-D-ribofuranoside is often used in organic synthesis, particularly in the preparation of nucleoside analogs and other carbohydrate derivatives. Its reactivity can be attributed to the presence of the acetyl groups, which can be hydrolyzed under specific conditions, making it useful in various chemical transformations.

Formula: C₁₂H₁₈O₈

InChI: InChI=1/C12H18O8/c1-6(13)17-5-9-10(18-7(2)14)11(19-8(3)15)12(16-4)20-9/h9-12H,5H2,1-4H3/t9-,10-,11-,12?/m1/s1

SMILES: CC(=O)OC[C@@H]1[C@H]([C@H](C(OC)O1)OC(=O)C)OC(=O)C

Synonyms:

• D-ribofuranoside, methyl, triacetate

Methyl 2,3,5-Tri-O-acetyl-D-ribofuranoside

CAS: 52554-28-6

Molecular weight: 290.27

Ref: 7W-GC2911

Methyl 2,3,5-Tri-O-acetyl-D-ribofuranoside

Controlled Product

CAS: 52554-28-6

Applications Methyl 2,3,5-Tri-O-acetyl-D-ribofuranoside (cas# 52554-28-6) is a compound useful in organic synthesis.

Formula: C₁₂H₁₈O₈

Color and Shape: Neat

Molecular weight: 290.27

Ref: TR-M330775

Methyl 2,3,5-tri-O-acetyl-D-ribofuranoside

CAS: 52554-28-6

Methyl 2,3,5-tri-O-acetyl-D-ribofuranoside is a natural product that has been shown to have immunomodulatory effects in vitro and in vivo. It inhibits the proliferation of various cancer cell lines and induces apoptosis. Methyl 2,3,5-tri-O-acetyl-D-ribofuranoside is also able to inhibit the activation of nuclear factor kappa B (NFκB), which is known to induce inflammation. Through its ability to inhibit NFκB activation, methyl 2,3,5-tri-O-acetyl-D-ribofuranoside may be able to reduce the severity of inflammatory skin diseases such as psoriasis.

Formula: C₁₂H₁₈O₈

Purity: Min. 95%

Color and Shape: Colorless Powder

Molecular weight: 290.27 g/mol

Ref: 3D-MM01878