CAS 525561-43-7

(2-chlorophenyl)(4-ethoxyphenyl)methanone

Description:

(2-chlorophenyl)(4-ethoxyphenyl)methanone, with the CAS number 525561-43-7, is an organic compound characterized by its ketone functional group, specifically a carbonyl group (C=O) bonded to a methanone structure. This compound features two aromatic rings: one containing a chlorine substituent at the ortho position and the other possessing an ethoxy group at the para position. The presence of these substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. Typically, compounds like this may exhibit moderate to high lipophilicity due to the aromatic rings, which can affect their behavior in biological systems. Additionally, the chlorine atom can impart unique electronic properties, potentially enhancing the compound's reactivity in electrophilic aromatic substitution reactions. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug development or as a building block in organic synthesis. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any health risks associated with exposure.

Formula: C₁₅H₁₃ClO₂

InChI: InChI=1/C15H13ClO2/c1-2-18-12-9-7-11(8-10-12)15(17)13-5-3-4-6-14(13)16/h3-10H,2H2,1H3

SMILES: CCOc1ccc(cc1)C(=O)c1ccccc1Cl

2-Chloro-4′-ethoxybenzophenone

CAS: 525561-43-7

Formula: C₁₅H₁₃ClO₂

Purity: 97.0%

Molecular weight: 260.72

Ref: 10-F202046

(2-Chlorophenyl)(4-ethoxyphenyl)methanone

CAS: 525561-43-7

Versatile small molecule scaffold

Formula: C₁₅H₁₃ClO₂

Purity: Min. 95%

Molecular weight: 260.71 g/mol

Ref: 3D-AWA56143