CAS 52557-98-9

3,3-Dimethylbicyclo[2.2.1]heptane-2-carboxylic acid

Description:

3,3-Dimethylbicyclo[2.2.1]heptane-2-carboxylic acid, with the CAS number 52557-98-9, is a bicyclic organic compound characterized by its unique bicyclo[2.2.1]heptane structure, which consists of a seven-membered ring system. This compound features two methyl groups at the 3-position and a carboxylic acid functional group at the 2-position, contributing to its chemical reactivity and potential applications. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The steric hindrance introduced by the dimethyl substituents can influence its reactivity and interactions with other molecules. Additionally, the compound's bicyclic framework may exhibit interesting conformational behavior and stability, making it a subject of interest in synthetic organic chemistry and materials science. Overall, 3,3-Dimethylbicyclo[2.2.1]heptane-2-carboxylic acid is notable for its structural complexity and potential utility in various chemical applications.

Formula: C₁₀H₁₆O₂

InChI: InChI=1S/C10H16O2/c1-10(2)7-4-3-6(5-7)8(10)9(11)12/h6-8H,3-5H2,1-2H3,(H,11,12)

InChI key: InChIKey=KJKODDSNIDHCKV-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C2CC(C1(C)C)CC2

Synonyms:

• NSC 239115
• 3-Camphenilanecarboxylic acid
• Bicyclo[2.2.1]heptane-2-carboxylic acid, 3,3-dimethyl-
• 3,3-Dimethylbicyclo[2.2.1]heptane-2-carboxylic acid
• 2-Norbornanecarboxylic acid, 3,3-dimethyl-

3,3-Dimethylbicyclo[2.2.1]heptane-2-carboxylic acid

CAS: 52557-98-9

Versatile small molecule scaffold

Formula: C₁₀H₁₆O₂

Purity: Min. 95%

Molecular weight: 168.23 g/mol

Ref: 3D-CCA55798