CAS 525570-78-9

4-[(2-chloro-5-fluoropyrimidin-4-yl)oxy]-3-methoxybenzaldehyde

Description:

4-[(2-chloro-5-fluoropyrimidin-4-yl)oxy]-3-methoxybenzaldehyde is an organic compound characterized by its complex structure, which includes a pyrimidine ring substituted with chlorine and fluorine atoms, as well as a methoxy group and an aldehyde functional group attached to a benzene ring. This compound is typically classified as an aromatic aldehyde due to the presence of the aldehyde (-CHO) group, which is known for its reactivity in various chemical reactions, including condensation and oxidation. The presence of the pyrimidine moiety suggests potential biological activity, as pyrimidine derivatives are often explored in medicinal chemistry for their roles in pharmaceuticals. The chlorine and fluorine substituents can influence the compound's lipophilicity, stability, and interaction with biological targets. Overall, this compound may exhibit interesting properties that could be relevant in drug development or as a chemical intermediate in synthetic organic chemistry.

Formula: C₁₂H₈ClFN₂O₃

InChI: InChI=1/C12H8ClFN2O3/c1-18-10-4-7(6-17)2-3-9(10)19-11-8(14)5-15-12(13)16-11/h2-6H,1H3

SMILES: COc1cc(ccc1Oc1c(cnc(Cl)n1)F)C=O

Synonyms:

• Benzaldehyde, 4-[(2-Chloro-5-Fluoro-4-Pyrimidinyl)Oxy]-3-Methoxy-
• 4-[(2-Chloro-5-fluoropyrimidin-4-yl)oxy]-3-methoxybenzaldehyde

4-[(2-chloro-5-fluoropyrimidin-4-yl)oxy]-3-methoxybenzaldehyde

CAS: 525570-78-9

Formula: C₁₂H₈ClFN₂O₃

Purity: 95.0%

Molecular weight: 282.66

Ref: 10-F315223