CAS 52568-84-0
:2,3,3-Trimethyl-3H-benz[f]indole
Description:
2,3,3-Trimethyl-3H-benz[f]indole is an organic compound belonging to the class of indoles, which are bicyclic structures containing a fused benzene and pyrrole ring. This particular compound features three methyl groups attached to the indole structure, specifically at the 2, 3, and 3 positions, which influences its chemical properties and reactivity. It is characterized by its aromatic nature, contributing to its stability and potential applications in various chemical reactions. The presence of multiple methyl groups can enhance its lipophilicity, affecting its solubility in organic solvents. This compound may exhibit fluorescence, making it of interest in materials science and organic electronics. Additionally, due to its structural features, it may participate in biological interactions, warranting investigation in pharmacological contexts. As with many indole derivatives, it may also serve as a precursor or intermediate in the synthesis of more complex organic molecules. Safety data and handling precautions should be observed, as with all chemical substances, to ensure safe laboratory practices.
Formula:C15H15N
InChI:InChI=1S/C15H15N/c1-10-15(2,3)13-8-11-6-4-5-7-12(11)9-14(13)16-10/h4-9H,1-3H3
InChI key:InChIKey=OOBXMOUQHBICOQ-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(=CC=3C(C2)=CC=CC3)N=C1C
Synonyms:- 3H-Benz[f]indole, 2,3,3-trimethyl-
- 2,3,3-Trimethyl-3H-benz[f]indole
- 2,3,3-Trimethyl-3H-benzo[f]indole
- 2,3,3-Trimethylbenz[f]indole
- 2,3,3-Trimethylbenzo[f]indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
