CAS 5257-06-7

N-(2-acetylphenyl)formamide

Description:

N-(2-acetylphenyl)formamide, with the CAS number 5257-06-7, is an organic compound characterized by its amide functional group and an acetylphenyl moiety. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents due to the presence of both the amide and acetyl groups, which can engage in hydrogen bonding. The structure features a phenyl ring substituted at the ortho position with an acetyl group, which influences its reactivity and potential applications in organic synthesis. N-(2-acetylphenyl)formamide may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis often involves the reaction of 2-acetylphenol with formamide, highlighting its relevance in various chemical processes. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions, making it essential to consult specific literature for detailed information. Overall, N-(2-acetylphenyl)formamide serves as a valuable intermediate in the synthesis of more complex organic molecules.

Formula: C₉H₉NO₂

InChI: InChI=1/C9H9NO2/c1-7(12)8-4-2-3-5-9(8)10-6-11/h2-6H,1H3,(H,10,11)

SMILES: CC(=O)c1ccccc1N=CO

Synonyms:

• formamide, N-(2-acetylphenyl)-

N-(2-Acetylphenyl)formamide

CAS: 5257-06-7

N-(2-Acetylphenyl)formamide

Purity: ≥95%

Molecular weight: 163.17g/mol

Ref: 54-OR27476