CAS 52574-08-0
:3-[[(Acetylamino)methyl]thio]propanoic acid
Description:
3-[[(Acetylamino)methyl]thio]propanoic acid, with the CAS number 52574-08-0, is an organic compound characterized by its unique functional groups and structure. It features a propanoic acid backbone, which is a three-carbon carboxylic acid, and is substituted with a thioether group that contains an acetylamino moiety. This compound exhibits both acidic and basic properties due to the presence of the carboxylic acid and the amino group, allowing it to participate in various chemical reactions, including esterification and amidation. The thioether linkage contributes to its potential reactivity and solubility in polar solvents. Additionally, the acetylamino group enhances its biological activity, making it of interest in pharmaceutical and biochemical applications. The compound's molecular structure suggests it may engage in hydrogen bonding, influencing its physical properties such as melting point and solubility. Overall, 3-[[(Acetylamino)methyl]thio]propanoic acid is a versatile compound with potential applications in medicinal chemistry and biochemistry.
Formula:C6H11NO3S
InChI:InChI=1S/C6H11NO3S/c1-5(8)7-4-11-3-2-6(9)10/h2-4H2,1H3,(H,7,8)(H,9,10)
InChI key:InChIKey=MTYMWQMQMYUQBD-UHFFFAOYSA-N
SMILES:C(CC(O)=O)SCNC(C)=O
Synonyms:- 3-[(Acetamidomethyl)sulfanyl]propanoic acid
- 3-[[(Acetylamino)methyl]sulfanyl]-propionic acid
- 3-[[(Acetylamino)methyl]thio]propanoic acid
- Acm-thiopropionic acid 3-(acethylamino-methylsulfanyl)-propionic acid
- Propanoic acid, 3-[[(acetylamino)methyl]thio]-
- β-(Acetamidomethylthio)propionic acid
- S-Acetamidomethyl-3- mercaptopropionic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-((Acetamidomethyl)thio)propanoic acid
CAS:Formula:C6H11NO3SPurity:97%Color and Shape:SolidMolecular weight:177.22143-((Acetamidomethyl)thio)propanoic acid
CAS:<p>3-((Acetamidomethyl)thio)propanoic acid</p>Purity:97%Molecular weight:177.22g/molS-Acm-ß-Mercaptopropionic Acid
CAS:<p>S-Acm-ß-Mercaptopropionic Acid is a selective activator of the human K+ channel KCNQ2/KCNQ3. It is a potent inhibitor of the hERG potassium channel. S-Acm-ß-Mercaptopropionic Acid is a ligand that binds to and activates KCNQ2 and KCNQ3 channels in heart muscle cells. It has shown to be an antibody for the study of ion channels, as well as other receptors and cell biology. This molecule has been used as a research tool for studying protein interactions and pharmacology.</p>Formula:C6H11NO3SPurity:Min. 95%Molecular weight:177.22 g/mol3-(Acetamidomethylthio)propanoic Acid (MPA(Acm)) extrapure, 98%
CAS:Formula:C6H11NO3SPurity:min. 98%Color and Shape:White, PowderMolecular weight:177.22





