CAS 52579-97-2: (1R,2S,6R,7R,8R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.0~2,6~]undecan-7-ol (non-preferred name)
Description:The chemical substance known as (1R,2S,6R,7R,8R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.0^2,6]undecan-7-ol, with the CAS number 52579-97-2, is a complex organic compound characterized by its unique tricyclic structure that incorporates multiple oxygen atoms in the form of ether and alcohol functional groups. This compound features a specific stereochemistry, indicated by its chiral centers, which contributes to its potential biological activity and interaction with other molecules. The presence of multiple oxygen atoms suggests that it may exhibit properties such as solubility in polar solvents and potential reactivity in various chemical environments. Its structural complexity may also imply interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, detailed studies on its specific applications, toxicity, and behavior in biological systems would be necessary to fully understand its characteristics and potential uses.
Formula:C9H14O5
InChI:InChI=1/C9H14O5/c1-9(2)13-6-4-3-11-8(12-4)5(10)7(6)14-9/h4-8,10H,3H2,1-2H3/t4-,5-,6+,7-,8-/m1/s1
- Synonyms:
- 1,6-Anhydro-3,4-O-isopropylidene-.beta.-D-galactopyranose
![(1R,2S,6R,7R,8R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.0~2,6~]undecan-7-ol (non-preferred n…](https://static.cymitquimica.com/cas-image/52611-1r-2s-6r-7r-8r-44-dimethyl-35911-tetraoxatricyclo-6-2-1-0-26-undecan-7-ol-non-preferred-name.png)
![(8S,8aR)-2,2-dimethylhexahydro-4,7-epoxy[1,3]dioxolo[4,5-d]oxepin-8-ol](https://static.cymitquimica.com/products/10/thumb/F774363.jpg)
