CAS 526-34-1
:7-Methoxy-1,3-benzodioxole-5-carboxylic acid
Description:
7-Methoxy-1,3-benzodioxole-5-carboxylic acid, with the CAS number 526-34-1, is an organic compound characterized by its unique structure, which includes a benzodioxole moiety and a carboxylic acid functional group. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar solvents such as water and alcohols, which is indicative of its polar functional groups. The presence of the methoxy group enhances its solubility and may influence its reactivity and biological activity. This compound is of interest in various fields, including medicinal chemistry and natural product synthesis, due to its potential pharmacological properties. Its structure suggests that it may participate in hydrogen bonding, which can affect its interactions with biological targets. Additionally, the carboxylic acid group can undergo typical acid-base reactions, making it a versatile building block in organic synthesis. Overall, 7-Methoxy-1,3-benzodioxole-5-carboxylic acid is a compound with significant chemical and biological relevance.
Formula:C9H8O5
InChI:InChI=1S/C9H8O5/c1-12-6-2-5(9(10)11)3-7-8(6)14-4-13-7/h2-3H,4H2,1H3,(H,10,11)
InChI key:InChIKey=AOHAPDDBNAPPIN-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(C(O)=O)=C1)OCO2
Synonyms:- 7-Methoxy-1,3-benzodioxole-5-carboxylic acid
- Benzoic acid, 3-methoxy-4,5-(methylenedioxy)-
- Myristicin acid
- Myristicic acid
- 1,3-Benzodioxole-5-carboxylic acid, 7-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
7-Methoxy-1,3-benzodioxide-5-carboxylic acid
CAS:Controlled Product7-Methoxy-1,3-benzodoxide-5-carboxylic acid is a synthetic fatty acid that has been designed to be resistant to thermal degradation. It has a molecular weight of 386.7 and a melting point of 153 degrees Celsius. 7-Methoxy-1,3-benzodoxide-5-carboxylic acid is used as a film forming polymer in cosmetics and pharmaceuticals. It can be used as an organic acid and the chloride salt can be used as a crosslinking agent for polymers. The compound is also useful as a viscosity modifier in reaction vessels for organic synthesis reactions. This compound is made up of fatty acids with multiple carboxyl groups and polybasic carbon chains.
Formula:C9H8O5Purity:Min. 95%Molecular weight:196.16 g/mol
